About 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride
2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride (PubChem CID 21153491) has the molecular formula C13H22Cl2N2O4
and a molecular weight of 341.24 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride |
| PubChem CID | 21153491 |
| Molecular Formula | C13H22Cl2N2O4 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride |
| SMILES | CN(C)CCOC(=O)N1CC2(CCCCC2Cl)OC1=O.Cl |
| InChI | InChI=1S/C13H21ClN2O4.ClH/c1-15(2)7-8-19-11(17)16-9-13(20-12(16)18)6-4-3-5-10(13)14;/h10H,3-9H2,1-2H3;1H |
| InChIKey | KXYPIGVMDCHNHC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride?
The IUPAC name of 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride (CID 21153491) is 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride.
What is the SMILES notation for 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride?
The canonical SMILES for 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride is CN(C)CCOC(=O)N1CC2(CCCCC2Cl)OC1=O.Cl.
What is the InChIKey of 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride?
The InChIKey is KXYPIGVMDCHNHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClN2O4.ClH/c1-15(2)7-8-19-11(17)16-9-13(20-12(16)18)6-4-3-5-10(13)14;/h10H,3-9H2,1-2H3;1H.
What are the key properties of 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride?
2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride has a molecular weight of 341.24 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 6-chloro-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate;hydrochloride is sourced from PubChem (CID 21153491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).