About N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide
N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide (PubChem CID 21153594) has the molecular formula C20H24N3O4+
and a molecular weight of 370.43 g/mol. Its IUPAC name is N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide |
| PubChem CID | 21153594 |
| Molecular Formula | C20H24N3O4+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide |
| SMILES | Cc1oc2ccc3c(C)cc(=O)oc3c2c1NC(=O)C[N+]1(C)CCNCC1 |
| InChI | InChI=1S/C20H23N3O4/c1-12-10-17(25)27-20-14(12)4-5-15-18(20)19(13(2)26-15)22-16(24)11-23(3)8-6-21-7-9-23/h4-5,10,21H,6-9,11H2,1-3H3/p+1 |
| InChIKey | KVHCNIXPESJYRG-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide?
The IUPAC name of N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide (CID 21153594) is N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide.
What is the SMILES notation for N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide?
The canonical SMILES for N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide is Cc1oc2ccc3c(C)cc(=O)oc3c2c1NC(=O)C[N+]1(C)CCNCC1.
What is the InChIKey of N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide?
The InChIKey is KVHCNIXPESJYRG-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H23N3O4/c1-12-10-17(25)27-20-14(12)4-5-15-18(20)19(13(2)26-15)22-16(24)11-23(3)8-6-21-7-9-23/h4-5,10,21H,6-9,11H2,1-3H3/p+1.
What are the key properties of N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide?
N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide has a molecular weight of 370.43 g/mol, XLogP of 2.14, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(1-methylpiperazin-1-ium-1-yl)acetamide is sourced from PubChem (CID 21153594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).