C27H26Cl2N2O5 — CID 21153641
butanoic acid;N-[2-[4-chloro-2-(2-chlorobenzoyl)-N-methylanilino]-2-oxoethyl]benzamide (PubChem CID 21153641) has the molecular formula C27H26Cl2N2O5 and a molecular weight of 529.42 g/mol. Its IUPAC name is butanoic acid;N-[2-[4-chloro-2-(2-chlorobenzoyl)-N-methylanilino]-2-oxoethyl]benzamide.
| Compound Name | butanoic acid;N-[2-[4-chloro-2-(2-chlorobenzoyl)-N-methylanilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 21153641 |
| Molecular Formula | C27H26Cl2N2O5 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | butanoic acid;N-[2-[4-chloro-2-(2-chlorobenzoyl)-N-methylanilino]-2-oxoethyl]benzamide |
| SMILES | CCCC(=O)O.CN(C(=O)CNC(=O)c1ccccc1)c1ccc(Cl)cc1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H18Cl2N2O3.C4H8O2/c1-27(21(28)14-26-23(30)15-7-3-2-4-8-15)20-12-11-16(24)13-18(20)22(29)17-9-5-6-10-19(17)25;1-2-3-4(5)6/h2-13H,14H2,1H3,(H,26,30);2-3H2,1H3,(H,5,6) |
| InChIKey | HXFABXZTNNZHIZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |