C16H13F2NS — CID 21153722
8-fluoro-3-(4-fluorophenyl)-1,3,4,5-tetrahydro-1-benzazepine-2-thione (PubChem CID 21153722) has the molecular formula C16H13F2NS and a molecular weight of 289.35 g/mol. Its IUPAC name is 8-fluoro-3-(4-fluorophenyl)-1,3,4,5-tetrahydro-1-benzazepine-2-thione.
| Compound Name | 8-fluoro-3-(4-fluorophenyl)-1,3,4,5-tetrahydro-1-benzazepine-2-thione |
|---|---|
| PubChem CID | 21153722 |
| Molecular Formula | C16H13F2NS |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 8-fluoro-3-(4-fluorophenyl)-1,3,4,5-tetrahydro-1-benzazepine-2-thione |
| SMILES | Fc1ccc(C2CCc3ccc(F)cc3NC2=S)cc1 |
| InChI | InChI=1S/C16H13F2NS/c17-12-5-1-10(2-6-12)14-8-4-11-3-7-13(18)9-15(11)19-16(14)20/h1-3,5-7,9,14H,4,8H2,(H,19,20) |
| InChIKey | VHPUWWJWDQEJBG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|