About N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide
N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide (PubChem CID 21153838) has the molecular formula C10H19IN3O3-
and a molecular weight of 356.18 g/mol. Its IUPAC name is N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide.
Molecular Properties
| Compound Name | N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide |
| PubChem CID | 21153838 |
| Molecular Formula | C10H19IN3O3- |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide |
| SMILES | CC[N+]1(C)NC(C)=CC1=O.CN(C)C(=O)[O-].[I-] |
| InChI | InChI=1S/C7H12N2O.C3H7NO2.HI/c1-4-9(3)7(10)5-6(2)8-9;1-4(2)3(5)6;/h5H,4H2,1-3H3;1-2H3,(H,5,6);1H/p-1 |
| InChIKey | VEFKSRNCWZEDOI-UHFFFAOYSA-M |
| XLogP | -3.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide?
The IUPAC name of N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide (CID 21153838) is N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide.
What is the SMILES notation for N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide?
The canonical SMILES for N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide is CC[N+]1(C)NC(C)=CC1=O.CN(C)C(=O)[O-].[I-].
What is the InChIKey of N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide?
The InChIKey is VEFKSRNCWZEDOI-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12N2O.C3H7NO2.HI/c1-4-9(3)7(10)5-6(2)8-9;1-4(2)3(5)6;/h5H,4H2,1-3H3;1-2H3,(H,5,6);1H/p-1.
What are the key properties of N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide?
N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide has a molecular weight of 356.18 g/mol, XLogP of -3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylcarbamate;2-ethyl-2,5-dimethyl-1H-pyrazol-2-ium-3-one;iodide is sourced from PubChem (CID 21153838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).