About N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride
N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride (PubChem CID 21153967) has the molecular formula C7H14Cl3NO3
and a molecular weight of 266.55 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride.
Molecular Properties
| Compound Name | N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride |
| PubChem CID | 21153967 |
| Molecular Formula | C7H14Cl3NO3 |
| Molecular Weight | 266.55 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride |
| SMILES | CC(C(=O)O)[N+]([O-])(CCCl)CCCl.Cl |
| InChI | InChI=1S/C7H13Cl2NO3.ClH/c1-6(7(11)12)10(13,4-2-8)5-3-9;/h6H,2-5H2,1H3,(H,11,12);1H |
| InChIKey | HXNTVEOFPJXJDZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.55 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride?
The IUPAC name of N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride (CID 21153967) is N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride.
What is the SMILES notation for N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride?
The canonical SMILES for N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride is CC(C(=O)O)[N+]([O-])(CCCl)CCCl.Cl.
What is the InChIKey of N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride?
The InChIKey is HXNTVEOFPJXJDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13Cl2NO3.ClH/c1-6(7(11)12)10(13,4-2-8)5-3-9;/h6H,2-5H2,1H3,(H,11,12);1H.
What are the key properties of N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride?
N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride has a molecular weight of 266.55 g/mol, XLogP of 1.67, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-chloroethyl)-1-hydroxy-1-oxopropan-2-amine oxide;hydrochloride is sourced from PubChem (CID 21153967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).