C23H25N5O4S2 — CID 2115438
2-[[5-(3-morpholin-4-ylsulfonylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide (PubChem CID 2115438) has the molecular formula C23H25N5O4S2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 2-[[5-(3-morpholin-4-ylsulfonylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[5-(3-morpholin-4-ylsulfonylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 2115438 |
| Molecular Formula | C23H25N5O4S2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 2-[[5-(3-morpholin-4-ylsulfonylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2)nnc1-c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C23H25N5O4S2/c1-2-11-28-22(25-26-23(28)33-17-21(29)24-19-8-4-3-5-9-19)18-7-6-10-20(16-18)34(30,31)27-12-14-32-15-13-27/h2-10,16H,1,11-15,17H2,(H,24,29) |
| InChIKey | LLOKWAWNBYCYHZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|