C11H6F4N2O2 — CID 2115504
N'-(2,3,5,6-tetrafluorophenyl)furan-2-carbohydrazide (PubChem CID 2115504) has the molecular formula C11H6F4N2O2 and a molecular weight of 274.17 g/mol. Its IUPAC name is N'-(2,3,5,6-tetrafluorophenyl)furan-2-carbohydrazide.
| Compound Name | N'-(2,3,5,6-tetrafluorophenyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 2115504 |
| Molecular Formula | C11H6F4N2O2 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N'-(2,3,5,6-tetrafluorophenyl)furan-2-carbohydrazide |
| SMILES | O=C(NNc1c(F)c(F)cc(F)c1F)c1ccco1 |
| InChI | InChI=1S/C11H6F4N2O2/c12-5-4-6(13)9(15)10(8(5)14)16-17-11(18)7-2-1-3-19-7/h1-4,16H,(H,17,18) |
| InChIKey | VUWRZWWHYRYMHG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|