C22H24INO5 — CID 21155216
2,3,8,9-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium;iodide;hydrate (PubChem CID 21155216) has the molecular formula C22H24INO5 and a molecular weight of 509.34 g/mol. Its IUPAC name is 2,3,8,9-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium;iodide;hydrate.
| Compound Name | 2,3,8,9-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium;iodide;hydrate |
|---|---|
| PubChem CID | 21155216 |
| Molecular Formula | C22H24INO5 |
| Molecular Weight | 509.34 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | 2,3,8,9-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium;iodide;hydrate |
| SMILES | COc1cc2c[n+](C)c3c4cc(OC)c(OC)cc4ccc3c2cc1OC.O.[I-] |
| InChI | InChI=1S/C22H22NO4.HI.H2O/c1-23-12-14-9-19(25-3)20(26-4)10-16(14)15-7-6-13-8-18(24-2)21(27-5)11-17(13)22(15)23;;/h6-12H,1-5H3;1H;1H2/q+1;;/p-1 |
| InChIKey | MMLRXQIJRHLJBH-UHFFFAOYSA-M |
| XLogP | 0.18 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|