C24H36N6O2S2 — CID 21155255
1,6-bis(4-methyl-6-morpholin-2-ylpyrimidin-2-yl)hexane-1,6-dithiol (PubChem CID 21155255) has the molecular formula C24H36N6O2S2 and a molecular weight of 504.73 g/mol. Its IUPAC name is 1,6-bis(4-methyl-6-morpholin-2-ylpyrimidin-2-yl)hexane-1,6-dithiol.
| Compound Name | 1,6-bis(4-methyl-6-morpholin-2-ylpyrimidin-2-yl)hexane-1,6-dithiol |
|---|---|
| PubChem CID | 21155255 |
| Molecular Formula | C24H36N6O2S2 |
| Molecular Weight | 504.73 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 1,6-bis(4-methyl-6-morpholin-2-ylpyrimidin-2-yl)hexane-1,6-dithiol |
| SMILES | Cc1cc(C2CNCCO2)nc(C(S)CCCCC(S)c2nc(C)cc(C3CNCCO3)n2)n1 |
| InChI | InChI=1S/C24H36N6O2S2/c1-15-11-17(19-13-25-7-9-31-19)29-23(27-15)21(33)5-3-4-6-22(34)24-28-16(2)12-18(30-24)20-14-26-8-10-32-20/h11-12,19-22,25-26,33-34H,3-10,13-14H2,1-2H3 |
| InChIKey | ZMFUFWAPNSGMDQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.73 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|