C27H35ClN4O4S2 — CID 21155270
ethyl (2R)-2-amino-3-[[4-methoxy-3-methyl-1-(5,5,7,7-tetramethyl-6-oxo-3H-cyclopenta[f]benzimidazol-2-yl)pyridin-1-ium-2-yl]methyldisulfanyl]propanoate chloride (PubChem CID 21155270) has the molecular formula C27H35ClN4O4S2 and a molecular weight of 579.19 g/mol. Its IUPAC name is ethyl (2R)-2-amino-3-[[4-methoxy-3-methyl-1-(5,5,7,7-tetramethyl-6-oxo-3H-cyclopenta[f]benzimidazol-2-yl)pyridin-1-ium-2-yl]methyldisulfanyl]propanoate chloride.
| Compound Name | ethyl (2R)-2-amino-3-[[4-methoxy-3-methyl-1-(5,5,7,7-tetramethyl-6-oxo-3H-cyclopenta[f]benzimidazol-2-yl)pyridin-1-ium-2-yl]methyldisulfanyl]propanoate chloride |
|---|---|
| PubChem CID | 21155270 |
| Molecular Formula | C27H35ClN4O4S2 |
| Molecular Weight | 579.19 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | ethyl (2R)-2-amino-3-[[4-methoxy-3-methyl-1-(5,5,7,7-tetramethyl-6-oxo-3H-cyclopenta[f]benzimidazol-2-yl)pyridin-1-ium-2-yl]methyldisulfanyl]propanoate chloride |
| SMILES | CCOC(=O)[C@@H](N)CSSCc1c(C)c(OC)cc[n+]1-c1nc2cc3c(cc2[nH]1)C(C)(C)C(=O)C3(C)C.[Cl-] |
| InChI | InChI=1S/C27H35N4O4S2.ClH/c1-8-35-23(32)18(28)13-36-37-14-21-15(2)22(34-7)9-10-31(21)25-29-19-11-16-17(12-20(19)30-25)27(5,6)24(33)26(16,3)4;/h9-12,18H,8,13-14,28H2,1-7H3,(H,29,30);1H/q+1;/p-1/t18-;/m0./s1 |
| InChIKey | WSHSGZIBEPHPNO-FERBBOLQSA-M |
| XLogP | 1.07 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|