C28H34O2S — CID 21155770
4,8,11,11-tetramethyl-1-phenylmethoxy-6-phenylsulfanylbicyclo[5.3.1]undec-7-en-3-one (PubChem CID 21155770) has the molecular formula C28H34O2S and a molecular weight of 434.65 g/mol. Its IUPAC name is 4,8,11,11-tetramethyl-1-phenylmethoxy-6-phenylsulfanylbicyclo[5.3.1]undec-7-en-3-one.
| Compound Name | 4,8,11,11-tetramethyl-1-phenylmethoxy-6-phenylsulfanylbicyclo[5.3.1]undec-7-en-3-one |
|---|---|
| PubChem CID | 21155770 |
| Molecular Formula | C28H34O2S |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 4,8,11,11-tetramethyl-1-phenylmethoxy-6-phenylsulfanylbicyclo[5.3.1]undec-7-en-3-one |
| SMILES | CC1=C2C(Sc3ccccc3)CC(C)C(=O)CC(OCc3ccccc3)(CC1)C2(C)C |
| InChI | InChI=1S/C28H34O2S/c1-20-15-16-28(30-19-22-11-7-5-8-12-22)18-24(29)21(2)17-25(26(20)27(28,3)4)31-23-13-9-6-10-14-23/h5-14,21,25H,15-19H2,1-4H3 |
| InChIKey | WWPVSSBILGYJRZ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|