About [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate
[2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate (PubChem CID 2115705) has the molecular formula C17H19NO7
and a molecular weight of 349.34 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate.
Molecular Properties
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate |
| PubChem CID | 2115705 |
| Molecular Formula | C17H19NO7 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)NCc2ccco2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19NO7/c1-21-13-7-11(8-14(22-2)16(13)23-3)17(20)25-10-15(19)18-9-12-5-4-6-24-12/h4-8H,9-10H2,1-3H3,(H,18,19) |
| InChIKey | VLJRBVOASYXOAA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate?
The IUPAC name of [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate (CID 2115705) is [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate.
What is the SMILES notation for [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate?
The canonical SMILES for [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate is COc1cc(C(=O)OCC(=O)NCc2ccco2)cc(OC)c1OC.
What is the InChIKey of [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate?
The InChIKey is VLJRBVOASYXOAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO7/c1-21-13-7-11(8-14(22-2)16(13)23-3)17(20)25-10-15(19)18-9-12-5-4-6-24-12/h4-8H,9-10H2,1-3H3,(H,18,19).
What are the key properties of [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate?
[2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate has a molecular weight of 349.34 g/mol, XLogP of 1.78, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,4,5-trimethoxybenzoate is sourced from PubChem (CID 2115705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).