C11H17N3O5S3 — CID 21157542
(4R)-4-(ethylamino)-1,1-dioxo-2-(3-oxopropyl)-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide (PubChem CID 21157542) has the molecular formula C11H17N3O5S3 and a molecular weight of 367.47 g/mol. Its IUPAC name is (4R)-4-(ethylamino)-1,1-dioxo-2-(3-oxopropyl)-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide.
| Compound Name | (4R)-4-(ethylamino)-1,1-dioxo-2-(3-oxopropyl)-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
|---|---|
| PubChem CID | 21157542 |
| Molecular Formula | C11H17N3O5S3 |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | (4R)-4-(ethylamino)-1,1-dioxo-2-(3-oxopropyl)-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
| SMILES | CCN[C@H]1CN(CCC=O)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C11H17N3O5S3/c1-2-13-9-7-14(4-3-5-15)22(18,19)11-8(9)6-10(20-11)21(12,16)17/h5-6,9,13H,2-4,7H2,1H3,(H2,12,16,17)/t9-/m0/s1 |
| InChIKey | SOIZPKZBDIHINM-VIFPVBQESA-N |
| XLogP | -0.36 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|