C9H17NO3 — CID 21158533
(E,2S,4R)-2-amino-3-hydroxy-4-methyloct-6-enoic acid (PubChem CID 21158533) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is (E,2S,4R)-2-amino-3-hydroxy-4-methyloct-6-enoic acid.
| Compound Name | (E,2S,4R)-2-amino-3-hydroxy-4-methyloct-6-enoic acid |
|---|---|
| PubChem CID | 21158533 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (E,2S,4R)-2-amino-3-hydroxy-4-methyloct-6-enoic acid |
| SMILES | C/C=C/C[C@@H](C)C(O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H17NO3/c1-3-4-5-6(2)8(11)7(10)9(12)13/h3-4,6-8,11H,5,10H2,1-2H3,(H,12,13)/b4-3+/t6-,7+,8?/m1/s1 |
| InChIKey | RPALEGQGCGCFCX-HYPFOYBRSA-N |
| XLogP | 0.36 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|