C7H14O6S — CID 21158835
(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-methylsulfanyloxyhexanal (PubChem CID 21158835) has the molecular formula C7H14O6S and a molecular weight of 226.25 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-methylsulfanyloxyhexanal.
| Compound Name | (2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-methylsulfanyloxyhexanal |
|---|---|
| PubChem CID | 21158835 |
| Molecular Formula | C7H14O6S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-methylsulfanyloxyhexanal |
| SMILES | CSO[C@@H]([C@H](O)[C@H](O)C=O)[C@H](O)CO |
| InChI | InChI=1S/C7H14O6S/c1-14-13-7(5(11)3-9)6(12)4(10)2-8/h2,4-7,9-12H,3H2,1H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | VYRBMYPQEUWURC-DBRKOABJSA-N |
| XLogP | -2.08 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|