C20H32O4 — CID 21159129
(1E,8R,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadeca-1,3-diene-2,5,5,6-tetrol (PubChem CID 21159129) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1E,8R,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadeca-1,3-diene-2,5,5,6-tetrol.
| Compound Name | (1E,8R,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadeca-1,3-diene-2,5,5,6-tetrol |
|---|---|
| PubChem CID | 21159129 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1E,8R,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadeca-1,3-diene-2,5,5,6-tetrol |
| SMILES | CC1=C2/C(O)=C3/CC[C@@H](C)[C@H](CC[C@]2(C)CC(O)C1(O)O)C3(C)C |
| InChI | InChI=1S/C20H32O4/c1-11-6-7-14-17(22)16-12(2)20(23,24)15(21)10-19(16,5)9-8-13(11)18(14,3)4/h11,13,15,21-24H,6-10H2,1-5H3/b17-14+/t11-,13+,15?,19-/m1/s1 |
| InChIKey | AEUAEUZDRWXMIH-JGTCLKPKSA-N |
| XLogP | 3.43 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|