About trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate
trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate (PubChem CID 21159433) has the molecular formula C26H48O4Si2
and a molecular weight of 480.84 g/mol. Its IUPAC name is trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate.
Molecular Properties
| Compound Name | trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate |
| PubChem CID | 21159433 |
| Molecular Formula | C26H48O4Si2 |
| Molecular Weight | 480.84 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate |
| SMILES | CCCCC[C@@H](/C=C/C1=C(CCCCCCC(=O)O[Si](C)(C)C)C(=O)CC1)O[Si](C)(C)C |
| InChI | InChI=1S/C26H48O4Si2/c1-8-9-12-15-23(29-31(2,3)4)20-18-22-19-21-25(27)24(22)16-13-10-11-14-17-26(28)30-32(5,6)7/h18,20,23H,8-17,19,21H2,1-7H3/b20-18+/t23-/m0/s1 |
| InChIKey | IUFSUDSDJVIXHR-TVNSMHFRSA-N |
| XLogP | 7.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.84 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate?
The IUPAC name of trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate (CID 21159433) is trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate.
What is the SMILES notation for trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate?
The canonical SMILES for trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate is CCCCC[C@@H](/C=C/C1=C(CCCCCCC(=O)O[Si](C)(C)C)C(=O)CC1)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate?
The InChIKey is IUFSUDSDJVIXHR-TVNSMHFRSA-N. The full InChI is InChI=1S/C26H48O4Si2/c1-8-9-12-15-23(29-31(2,3)4)20-18-22-19-21-25(27)24(22)16-13-10-11-14-17-26(28)30-32(5,6)7/h18,20,23H,8-17,19,21H2,1-7H3/b20-18+/t23-/m0/s1.
What are the key properties of trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate?
trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate has a molecular weight of 480.84 g/mol, XLogP of 7.72, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 7-[5-oxo-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate is sourced from PubChem (CID 21159433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).