C27H52O4Si2 — CID 21159708
1,3-bis(trimethylsilyloxy)propan-2-yl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 21159708) has the molecular formula C27H52O4Si2 and a molecular weight of 496.88 g/mol. Its IUPAC name is 1,3-bis(trimethylsilyloxy)propan-2-yl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | 1,3-bis(trimethylsilyloxy)propan-2-yl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 21159708 |
| Molecular Formula | C27H52O4Si2 |
| Molecular Weight | 496.88 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | 1,3-bis(trimethylsilyloxy)propan-2-yl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C |
| InChI | InChI=1S/C27H52O4Si2/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(28)31-26(24-29-32(2,3)4)25-30-33(5,6)7/h9-10,12-13,15-16,26H,8,11,14,17-25H2,1-7H3/b10-9-,13-12-,16-15- |
| InChIKey | JCKCKIGYQKMCHR-YOILPLPUSA-N |
| XLogP | 8.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.88 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|