C15H24O3 — CID 21159762
(3E,5Z)-6-(2-hydroxypropan-2-yl)-2,9-dimethyldeca-3,5-dien-7-yne-2,9-diol (PubChem CID 21159762) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (3E,5Z)-6-(2-hydroxypropan-2-yl)-2,9-dimethyldeca-3,5-dien-7-yne-2,9-diol.
| Compound Name | (3E,5Z)-6-(2-hydroxypropan-2-yl)-2,9-dimethyldeca-3,5-dien-7-yne-2,9-diol |
|---|---|
| PubChem CID | 21159762 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3E,5Z)-6-(2-hydroxypropan-2-yl)-2,9-dimethyldeca-3,5-dien-7-yne-2,9-diol |
| SMILES | CC(C)(O)C#C/C(=C/C=C/C(C)(C)O)C(C)(C)O |
| InChI | InChI=1S/C15H24O3/c1-13(2,16)10-7-8-12(15(5,6)18)9-11-14(3,4)17/h7-8,10,16-18H,1-6H3/b10-7+,12-8- |
| InChIKey | SVJPHTBNOANREV-NFZZJPOKSA-N |
| XLogP | 1.79 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|