C16H28O2 — CID 21160012
methyl (3S,6E)-3,7,11-trimethyldodeca-6,10-dienoate (PubChem CID 21160012) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is methyl (3S,6E)-3,7,11-trimethyldodeca-6,10-dienoate.
| Compound Name | methyl (3S,6E)-3,7,11-trimethyldodeca-6,10-dienoate |
|---|---|
| PubChem CID | 21160012 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | methyl (3S,6E)-3,7,11-trimethyldodeca-6,10-dienoate |
| SMILES | COC(=O)C[C@@H](C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H28O2/c1-13(2)8-6-9-14(3)10-7-11-15(4)12-16(17)18-5/h8,10,15H,6-7,9,11-12H2,1-5H3/b14-10+/t15-/m0/s1 |
| InChIKey | KDRPMFBDXUEDPC-IPJDOKCGSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|