C32H68O5Si4 — CID 21160061
trimethylsilyl 7-[(1R,2R,3R,5R)-3,5-bis(trimethylsilyloxy)-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]heptanoate (PubChem CID 21160061) has the molecular formula C32H68O5Si4 and a molecular weight of 645.24 g/mol. Its IUPAC name is trimethylsilyl 7-[(1R,2R,3R,5R)-3,5-bis(trimethylsilyloxy)-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]heptanoate.
| Compound Name | trimethylsilyl 7-[(1R,2R,3R,5R)-3,5-bis(trimethylsilyloxy)-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 21160061 |
| Molecular Formula | C32H68O5Si4 |
| Molecular Weight | 645.24 g/mol |
| Exact Mass | 644.41 |
| IUPAC Name | trimethylsilyl 7-[(1R,2R,3R,5R)-3,5-bis(trimethylsilyloxy)-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]heptanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](CCCCCCC(=O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C[C@H]1O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C32H68O5Si4/c1-14-15-18-21-27(34-38(2,3)4)24-25-29-28(22-19-16-17-20-23-32(33)37-41(11,12)13)30(35-39(5,6)7)26-31(29)36-40(8,9)10/h24-25,27-31H,14-23,26H2,1-13H3/b25-24+/t27-,28+,29+,30+,31+/m0/s1 |
| InChIKey | FKCQXUAYSAIKMH-WNNHCMEYSA-N |
| XLogP | 10.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.24 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|