About (Z)-2-methoxyoct-2-ene
(Z)-2-methoxyoct-2-ene (PubChem CID 21160202) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is (Z)-2-methoxyoct-2-ene.
Molecular Properties
| Compound Name | (Z)-2-methoxyoct-2-ene |
| PubChem CID | 21160202 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (Z)-2-methoxyoct-2-ene |
| SMILES | CCCCC/C=C(/C)OC |
| InChI | InChI=1S/C9H18O/c1-4-5-6-7-8-9(2)10-3/h8H,4-7H2,1-3H3/b9-8- |
| InChIKey | XEPKSKJTPUOMQC-HJWRWDBZSA-N |
| XLogP | 3.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-methoxyoct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-methoxyoct-2-ene?
The IUPAC name of (Z)-2-methoxyoct-2-ene (CID 21160202) is (Z)-2-methoxyoct-2-ene.
What is the SMILES notation for (Z)-2-methoxyoct-2-ene?
The canonical SMILES for (Z)-2-methoxyoct-2-ene is CCCCC/C=C(/C)OC.
What is the InChIKey of (Z)-2-methoxyoct-2-ene?
The InChIKey is XEPKSKJTPUOMQC-HJWRWDBZSA-N. The full InChI is InChI=1S/C9H18O/c1-4-5-6-7-8-9(2)10-3/h8H,4-7H2,1-3H3/b9-8-.
What are the key properties of (Z)-2-methoxyoct-2-ene?
(Z)-2-methoxyoct-2-ene has a molecular weight of 142.24 g/mol, XLogP of 3.12, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-methoxyoct-2-ene is sourced from PubChem (CID 21160202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).