C14H22 — CID 21160273
(1Z,5Z)-8,8-dimethyl-9-methylidenecycloundeca-1,5-diene (PubChem CID 21160273) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (1Z,5Z)-8,8-dimethyl-9-methylidenecycloundeca-1,5-diene.
| Compound Name | (1Z,5Z)-8,8-dimethyl-9-methylidenecycloundeca-1,5-diene |
|---|---|
| PubChem CID | 21160273 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (1Z,5Z)-8,8-dimethyl-9-methylidenecycloundeca-1,5-diene |
| SMILES | C=C1CC/C=C\CC/C=C\CC1(C)C |
| InChI | InChI=1S/C14H22/c1-13-11-9-7-5-4-6-8-10-12-14(13,2)3/h5,7-8,10H,1,4,6,9,11-12H2,2-3H3/b7-5-,10-8- |
| InChIKey | JGOFSHMHNOXTRH-RRMOSLQNSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|