C10H17N5S — CID 21161206
4,6-bis(propan-2-ylamino)-1,3,5-triazine-2-carbothialdehyde (PubChem CID 21161206) has the molecular formula C10H17N5S and a molecular weight of 239.35 g/mol. Its IUPAC name is 4,6-bis(propan-2-ylamino)-1,3,5-triazine-2-carbothialdehyde.
| Compound Name | 4,6-bis(propan-2-ylamino)-1,3,5-triazine-2-carbothialdehyde |
|---|---|
| PubChem CID | 21161206 |
| Molecular Formula | C10H17N5S |
| Molecular Weight | 239.35 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 4,6-bis(propan-2-ylamino)-1,3,5-triazine-2-carbothialdehyde |
| SMILES | CC(C)Nc1nc(C=S)nc(NC(C)C)n1 |
| InChI | InChI=1S/C10H17N5S/c1-6(2)11-9-13-8(5-16)14-10(15-9)12-7(3)4/h5-7H,1-4H3,(H2,11,12,13,14,15) |
| InChIKey | NKOJROPIZHASMZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|