C9H9BrClFN4O — CID 21161259
1-(4-bromo-2-chloro-6-fluorophenyl)-3-(diaminomethylidene)-1-methylurea (PubChem CID 21161259) has the molecular formula C9H9BrClFN4O and a molecular weight of 323.55 g/mol. Its IUPAC name is 1-(4-bromo-2-chloro-6-fluorophenyl)-3-(diaminomethylidene)-1-methylurea.
| Compound Name | 1-(4-bromo-2-chloro-6-fluorophenyl)-3-(diaminomethylidene)-1-methylurea |
|---|---|
| PubChem CID | 21161259 |
| Molecular Formula | C9H9BrClFN4O |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 1-(4-bromo-2-chloro-6-fluorophenyl)-3-(diaminomethylidene)-1-methylurea |
| SMILES | CN(C(=O)N=C(N)N)c1c(F)cc(Br)cc1Cl |
| InChI | InChI=1S/C9H9BrClFN4O/c1-16(9(17)15-8(13)14)7-5(11)2-4(10)3-6(7)12/h2-3H,1H3,(H4,13,14,15,17) |
| InChIKey | KHQPWOJZFJYQHD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|