About 2-bromo-4,6-difluoro-N-methylaniline
2-bromo-4,6-difluoro-N-methylaniline (PubChem CID 21161558) has the molecular formula C7H6BrF2N
and a molecular weight of 222.03 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-methylaniline.
Molecular Properties
| Compound Name | 2-bromo-4,6-difluoro-N-methylaniline |
| PubChem CID | 21161558 |
| Molecular Formula | C7H6BrF2N |
| Molecular Weight | 222.03 g/mol |
| Exact Mass | 220.97 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-methylaniline |
| SMILES | CNc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C7H6BrF2N/c1-11-7-5(8)2-4(9)3-6(7)10/h2-3,11H,1H3 |
| InChIKey | MEGICNYNMGRCIB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.03 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-4,6-difluoro-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,6-difluoro-N-methylaniline?
The IUPAC name of 2-bromo-4,6-difluoro-N-methylaniline (CID 21161558) is 2-bromo-4,6-difluoro-N-methylaniline.
What is the SMILES notation for 2-bromo-4,6-difluoro-N-methylaniline?
The canonical SMILES for 2-bromo-4,6-difluoro-N-methylaniline is CNc1c(F)cc(F)cc1Br.
What is the InChIKey of 2-bromo-4,6-difluoro-N-methylaniline?
The InChIKey is MEGICNYNMGRCIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrF2N/c1-11-7-5(8)2-4(9)3-6(7)10/h2-3,11H,1H3.
What are the key properties of 2-bromo-4,6-difluoro-N-methylaniline?
2-bromo-4,6-difluoro-N-methylaniline has a molecular weight of 222.03 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,6-difluoro-N-methylaniline is sourced from PubChem (CID 21161558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).