About 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol
4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol (PubChem CID 21161609) has the molecular formula C14H15ClO2
and a molecular weight of 250.73 g/mol. Its IUPAC name is 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol.
Molecular Properties
| Compound Name | 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol |
| PubChem CID | 21161609 |
| Molecular Formula | C14H15ClO2 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol |
| SMILES | CC(c1ccc(O)cc1)C1(O)C=CC=CC1Cl |
| InChI | InChI=1S/C14H15ClO2/c1-10(11-5-7-12(16)8-6-11)14(17)9-3-2-4-13(14)15/h2-10,13,16-17H,1H3 |
| InChIKey | IAEAFJXKTBQKES-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol?
The IUPAC name of 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol (CID 21161609) is 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol.
What is the SMILES notation for 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol?
The canonical SMILES for 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol is CC(c1ccc(O)cc1)C1(O)C=CC=CC1Cl.
What is the InChIKey of 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol?
The InChIKey is IAEAFJXKTBQKES-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClO2/c1-10(11-5-7-12(16)8-6-11)14(17)9-3-2-4-13(14)15/h2-10,13,16-17H,1H3.
What are the key properties of 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol?
4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol has a molecular weight of 250.73 g/mol, XLogP of 2.96, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(6-chloro-1-hydroxycyclohexa-2,4-dien-1-yl)ethyl]phenol is sourced from PubChem (CID 21161609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).