About 2,2-diethoxythiolane
2,2-diethoxythiolane (PubChem CID 21161897) has the molecular formula C8H16O2S
and a molecular weight of 176.28 g/mol. Its IUPAC name is 2,2-diethoxythiolane.
Molecular Properties
| Compound Name | 2,2-diethoxythiolane |
| PubChem CID | 21161897 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2,2-diethoxythiolane |
| SMILES | CCOC1(OCC)CCCS1 |
| InChI | InChI=1S/C8H16O2S/c1-3-9-8(10-4-2)6-5-7-11-8/h3-7H2,1-2H3 |
| InChIKey | YQUASXLHODEBRC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethoxythiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethoxythiolane?
The IUPAC name of 2,2-diethoxythiolane (CID 21161897) is 2,2-diethoxythiolane.
What is the SMILES notation for 2,2-diethoxythiolane?
The canonical SMILES for 2,2-diethoxythiolane is CCOC1(OCC)CCCS1.
What is the InChIKey of 2,2-diethoxythiolane?
The InChIKey is YQUASXLHODEBRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2S/c1-3-9-8(10-4-2)6-5-7-11-8/h3-7H2,1-2H3.
What are the key properties of 2,2-diethoxythiolane?
2,2-diethoxythiolane has a molecular weight of 176.28 g/mol, XLogP of 2.24, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethoxythiolane is sourced from PubChem (CID 21161897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).