About 2,2-diethoxythiocane
2,2-diethoxythiocane (PubChem CID 21161903) has the molecular formula C11H22O2S
and a molecular weight of 218.36 g/mol. Its IUPAC name is 2,2-diethoxythiocane.
Molecular Properties
| Compound Name | 2,2-diethoxythiocane |
| PubChem CID | 21161903 |
| Molecular Formula | C11H22O2S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2,2-diethoxythiocane |
| SMILES | CCOC1(OCC)CCCCCCS1 |
| InChI | InChI=1S/C11H22O2S/c1-3-12-11(13-4-2)9-7-5-6-8-10-14-11/h3-10H2,1-2H3 |
| InChIKey | YAMKZFGKDQUJJK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethoxythiocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethoxythiocane?
The IUPAC name of 2,2-diethoxythiocane (CID 21161903) is 2,2-diethoxythiocane.
What is the SMILES notation for 2,2-diethoxythiocane?
The canonical SMILES for 2,2-diethoxythiocane is CCOC1(OCC)CCCCCCS1.
What is the InChIKey of 2,2-diethoxythiocane?
The InChIKey is YAMKZFGKDQUJJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2S/c1-3-12-11(13-4-2)9-7-5-6-8-10-14-11/h3-10H2,1-2H3.
What are the key properties of 2,2-diethoxythiocane?
2,2-diethoxythiocane has a molecular weight of 218.36 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethoxythiocane is sourced from PubChem (CID 21161903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).