C7H9N3O4S — CID 21161984
2-cyano-N-(2-methylsulfonylacetyl)aziridine-1-carboxamide (PubChem CID 21161984) has the molecular formula C7H9N3O4S and a molecular weight of 231.23 g/mol. Its IUPAC name is 2-cyano-N-(2-methylsulfonylacetyl)aziridine-1-carboxamide.
| Compound Name | 2-cyano-N-(2-methylsulfonylacetyl)aziridine-1-carboxamide |
|---|---|
| PubChem CID | 21161984 |
| Molecular Formula | C7H9N3O4S |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-cyano-N-(2-methylsulfonylacetyl)aziridine-1-carboxamide |
| SMILES | CS(=O)(=O)CC(=O)NC(=O)N1CC1C#N |
| InChI | InChI=1S/C7H9N3O4S/c1-15(13,14)4-6(11)9-7(12)10-3-5(10)2-8/h5H,3-4H2,1H3,(H,9,11,12) |
| InChIKey | NIIBOFZLPYHQNO-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|