About N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine
N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine (PubChem CID 21162005) has the molecular formula C8H14N4O2
and a molecular weight of 198.23 g/mol. Its IUPAC name is N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine.
Molecular Properties
| Compound Name | N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine |
| PubChem CID | 21162005 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine |
| SMILES | CC(=O)NC(=O)N1CC1C#N.CNC |
| InChI | InChI=1S/C6H7N3O2.C2H7N/c1-4(10)8-6(11)9-3-5(9)2-7;1-3-2/h5H,3H2,1H3,(H,8,10,11);3H,1-2H3 |
| InChIKey | JTCIWHAQGDMAQC-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine?
The IUPAC name of N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine (CID 21162005) is N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine.
What is the SMILES notation for N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine?
The canonical SMILES for N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine is CC(=O)NC(=O)N1CC1C#N.CNC.
What is the InChIKey of N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine?
The InChIKey is JTCIWHAQGDMAQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2.C2H7N/c1-4(10)8-6(11)9-3-5(9)2-7;1-3-2/h5H,3H2,1H3,(H,8,10,11);3H,1-2H3.
What are the key properties of N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine?
N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine has a molecular weight of 198.23 g/mol, XLogP of -0.71, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-2-cyanoaziridine-1-carboxamide;N-methylmethanamine is sourced from PubChem (CID 21162005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).