C14H15ClFNO2S — CID 21162134
4-(2-fluoro-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl)benzene-1,2-diol;hydrochloride (PubChem CID 21162134) has the molecular formula C14H15ClFNO2S and a molecular weight of 315.80 g/mol. Its IUPAC name is 4-(2-fluoro-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl)benzene-1,2-diol;hydrochloride.
| Compound Name | 4-(2-fluoro-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl)benzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 21162134 |
| Molecular Formula | C14H15ClFNO2S |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 4-(2-fluoro-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl)benzene-1,2-diol;hydrochloride |
| SMILES | CN1Cc2sc(F)cc2C(c2ccc(O)c(O)c2)C1.Cl |
| InChI | InChI=1S/C14H14FNO2S.ClH/c1-16-6-10(8-2-3-11(17)12(18)4-8)9-5-14(15)19-13(9)7-16;/h2-5,10,17-18H,6-7H2,1H3;1H |
| InChIKey | IYOAPKATXCSZMZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|