About 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole]
6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole] (PubChem CID 21162154) has the molecular formula C11H9FN2O
and a molecular weight of 204.20 g/mol. Its IUPAC name is 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole].
Molecular Properties
| Compound Name | 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole] |
| PubChem CID | 21162154 |
| Molecular Formula | C11H9FN2O |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole] |
| SMILES | Fc1ccc2c(c1)C1(C=NC=N1)CCO2 |
| InChI | InChI=1S/C11H9FN2O/c12-8-1-2-10-9(5-8)11(3-4-15-10)6-13-7-14-11/h1-2,5-7H,3-4H2 |
| InChIKey | VUIFLEQKJUBGTJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole]?
The IUPAC name of 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole] (CID 21162154) is 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole].
What is the SMILES notation for 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole]?
The canonical SMILES for 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole] is Fc1ccc2c(c1)C1(C=NC=N1)CCO2.
What is the InChIKey of 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole]?
The InChIKey is VUIFLEQKJUBGTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2O/c12-8-1-2-10-9(5-8)11(3-4-15-10)6-13-7-14-11/h1-2,5-7H,3-4H2.
What are the key properties of 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole]?
6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole] has a molecular weight of 204.20 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluorospiro[2,3-dihydrochromene-4,4'-imidazole] is sourced from PubChem (CID 21162154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).