C12H12N2O2 — CID 21162203
6-methylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 21162203) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 6-methylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-methylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 21162203 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 6-methylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccc2c(c1)CCC21NC(=O)NC1=O |
| InChI | InChI=1S/C12H12N2O2/c1-7-2-3-9-8(6-7)4-5-12(9)10(15)13-11(16)14-12/h2-3,6H,4-5H2,1H3,(H2,13,14,15,16) |
| InChIKey | ZFLNOKMYQNNENE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|