About 2-ethyl-1,3-thiazolidine-3-carboxylic acid
2-ethyl-1,3-thiazolidine-3-carboxylic acid (PubChem CID 21162291) has the molecular formula C6H11NO2S
and a molecular weight of 161.23 g/mol. Its IUPAC name is 2-ethyl-1,3-thiazolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-ethyl-1,3-thiazolidine-3-carboxylic acid |
| PubChem CID | 21162291 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 2-ethyl-1,3-thiazolidine-3-carboxylic acid |
| SMILES | CCC1SCCN1C(=O)O |
| InChI | InChI=1S/C6H11NO2S/c1-2-5-7(6(8)9)3-4-10-5/h5H,2-4H2,1H3,(H,8,9) |
| InChIKey | STLAFUVLTFDORG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-1,3-thiazolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,3-thiazolidine-3-carboxylic acid?
The IUPAC name of 2-ethyl-1,3-thiazolidine-3-carboxylic acid (CID 21162291) is 2-ethyl-1,3-thiazolidine-3-carboxylic acid.
What is the SMILES notation for 2-ethyl-1,3-thiazolidine-3-carboxylic acid?
The canonical SMILES for 2-ethyl-1,3-thiazolidine-3-carboxylic acid is CCC1SCCN1C(=O)O.
What is the InChIKey of 2-ethyl-1,3-thiazolidine-3-carboxylic acid?
The InChIKey is STLAFUVLTFDORG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2S/c1-2-5-7(6(8)9)3-4-10-5/h5H,2-4H2,1H3,(H,8,9).
What are the key properties of 2-ethyl-1,3-thiazolidine-3-carboxylic acid?
2-ethyl-1,3-thiazolidine-3-carboxylic acid has a molecular weight of 161.23 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,3-thiazolidine-3-carboxylic acid is sourced from PubChem (CID 21162291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).