C10H8Cl2F3NO2S — CID 21162405
2-(1,2-dichloro-1,2,2-trifluoroethyl)sulfanyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 21162405) has the molecular formula C10H8Cl2F3NO2S and a molecular weight of 334.15 g/mol. Its IUPAC name is 2-(1,2-dichloro-1,2,2-trifluoroethyl)sulfanyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(1,2-dichloro-1,2,2-trifluoroethyl)sulfanyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 21162405 |
| Molecular Formula | C10H8Cl2F3NO2S |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 2-(1,2-dichloro-1,2,2-trifluoroethyl)sulfanyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2C=CCCC2C(=O)N1SC(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C10H8Cl2F3NO2S/c11-9(13,14)10(12,15)19-16-7(17)5-3-1-2-4-6(5)8(16)18/h1,3,5-6H,2,4H2 |
| InChIKey | YLGSVUZVGYPLLJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|