C17H14FNO2S — CID 21162412
2-[4-(1-cyanoethyl)phenyl]sulfanyl-2-(3-fluorophenyl)acetic acid (PubChem CID 21162412) has the molecular formula C17H14FNO2S and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[4-(1-cyanoethyl)phenyl]sulfanyl-2-(3-fluorophenyl)acetic acid.
| Compound Name | 2-[4-(1-cyanoethyl)phenyl]sulfanyl-2-(3-fluorophenyl)acetic acid |
|---|---|
| PubChem CID | 21162412 |
| Molecular Formula | C17H14FNO2S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-[4-(1-cyanoethyl)phenyl]sulfanyl-2-(3-fluorophenyl)acetic acid |
| SMILES | CC(C#N)c1ccc(SC(C(=O)O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H14FNO2S/c1-11(10-19)12-5-7-15(8-6-12)22-16(17(20)21)13-3-2-4-14(18)9-13/h2-9,11,16H,1H3,(H,20,21) |
| InChIKey | YENDCGRQDMTVLG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |