About 4-hexylcyclohexane-1,2-dithiol
4-hexylcyclohexane-1,2-dithiol (PubChem CID 21162889) has the molecular formula C12H24S2
and a molecular weight of 232.46 g/mol. Its IUPAC name is 4-hexylcyclohexane-1,2-dithiol.
Molecular Properties
| Compound Name | 4-hexylcyclohexane-1,2-dithiol |
| PubChem CID | 21162889 |
| Molecular Formula | C12H24S2 |
| Molecular Weight | 232.46 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 4-hexylcyclohexane-1,2-dithiol |
| SMILES | CCCCCCC1CCC(S)C(S)C1 |
| InChI | InChI=1S/C12H24S2/c1-2-3-4-5-6-10-7-8-11(13)12(14)9-10/h10-14H,2-9H2,1H3 |
| InChIKey | CMJSNQMLGXDBTP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hexylcyclohexane-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexylcyclohexane-1,2-dithiol?
The IUPAC name of 4-hexylcyclohexane-1,2-dithiol (CID 21162889) is 4-hexylcyclohexane-1,2-dithiol.
What is the SMILES notation for 4-hexylcyclohexane-1,2-dithiol?
The canonical SMILES for 4-hexylcyclohexane-1,2-dithiol is CCCCCCC1CCC(S)C(S)C1.
What is the InChIKey of 4-hexylcyclohexane-1,2-dithiol?
The InChIKey is CMJSNQMLGXDBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24S2/c1-2-3-4-5-6-10-7-8-11(13)12(14)9-10/h10-14H,2-9H2,1H3.
What are the key properties of 4-hexylcyclohexane-1,2-dithiol?
4-hexylcyclohexane-1,2-dithiol has a molecular weight of 232.46 g/mol, XLogP of 4.35, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexylcyclohexane-1,2-dithiol is sourced from PubChem (CID 21162889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).