C6H11N7O — CID 21162911
prop-2-enamide;1,3,5-triazine-2,4,6-triamine (PubChem CID 21162911) has the molecular formula C6H11N7O and a molecular weight of 197.20 g/mol. Its IUPAC name is prop-2-enamide;1,3,5-triazine-2,4,6-triamine.
| Compound Name | prop-2-enamide;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 21162911 |
| Molecular Formula | C6H11N7O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | prop-2-enamide;1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CC(N)=O.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C3H6N6.C3H5NO/c4-1-7-2(5)9-3(6)8-1;1-2-3(4)5/h(H6,4,5,6,7,8,9);2H,1H2,(H2,4,5) |
| InChIKey | KYEQSRPOTWVMBF-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|