C20H35ClN2O8S4 — CID 21163755
4-[2-[2-chloro-5-(2-morpholin-4-ylethylsulfanyl)phenyl]sulfanylethyl]morpholine;methanesulfonic acid (PubChem CID 21163755) has the molecular formula C20H35ClN2O8S4 and a molecular weight of 595.23 g/mol. Its IUPAC name is 4-[2-[2-chloro-5-(2-morpholin-4-ylethylsulfanyl)phenyl]sulfanylethyl]morpholine;methanesulfonic acid.
| Compound Name | 4-[2-[2-chloro-5-(2-morpholin-4-ylethylsulfanyl)phenyl]sulfanylethyl]morpholine;methanesulfonic acid |
|---|---|
| PubChem CID | 21163755 |
| Molecular Formula | C20H35ClN2O8S4 |
| Molecular Weight | 595.23 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | 4-[2-[2-chloro-5-(2-morpholin-4-ylethylsulfanyl)phenyl]sulfanylethyl]morpholine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.Clc1ccc(SCCN2CCOCC2)cc1SCCN1CCOCC1 |
| InChI | InChI=1S/C18H27ClN2O2S2.2CH4O3S/c19-17-2-1-16(24-13-7-20-3-9-22-10-4-20)15-18(17)25-14-8-21-5-11-23-12-6-21;2*1-5(2,3)4/h1-2,15H,3-14H2;2*1H3,(H,2,3,4) |
| InChIKey | GYQFVAYTZUBONB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|