About 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile
5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile (PubChem CID 21163780) has the molecular formula C8H11N3OS2
and a molecular weight of 229.33 g/mol. Its IUPAC name is 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile.
Molecular Properties
| Compound Name | 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile |
| PubChem CID | 21163780 |
| Molecular Formula | C8H11N3OS2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile |
| SMILES | CCCCCS(=O)c1nnc(C#N)s1 |
| InChI | InChI=1S/C8H11N3OS2/c1-2-3-4-5-14(12)8-11-10-7(6-9)13-8/h2-5H2,1H3 |
| InChIKey | ZTQKDCOBLSXWHT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 66.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile?
The IUPAC name of 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile (CID 21163780) is 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile.
What is the SMILES notation for 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile?
The canonical SMILES for 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile is CCCCCS(=O)c1nnc(C#N)s1.
What is the InChIKey of 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile?
The InChIKey is ZTQKDCOBLSXWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3OS2/c1-2-3-4-5-14(12)8-11-10-7(6-9)13-8/h2-5H2,1H3.
What are the key properties of 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile?
5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile has a molecular weight of 229.33 g/mol, XLogP of 1.71, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentylsulfinyl-1,3,4-thiadiazole-2-carbonitrile is sourced from PubChem (CID 21163780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).