About 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide
5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 21163834) has the molecular formula C4H5N3O3S2
and a molecular weight of 207.24 g/mol. Its IUPAC name is 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide |
| PubChem CID | 21163834 |
| Molecular Formula | C4H5N3O3S2 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 206.98 |
| IUPAC Name | 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CS(=O)(=O)c1nnc(C(N)=O)s1 |
| InChI | InChI=1S/C4H5N3O3S2/c1-12(9,10)4-7-6-3(11-4)2(5)8/h1H3,(H2,5,8) |
| InChIKey | RYWUNYZQGWXGHA-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide?
The IUPAC name of 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide (CID 21163834) is 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide.
What is the SMILES notation for 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide?
The canonical SMILES for 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide is CS(=O)(=O)c1nnc(C(N)=O)s1.
What is the InChIKey of 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide?
The InChIKey is RYWUNYZQGWXGHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O3S2/c1-12(9,10)4-7-6-3(11-4)2(5)8/h1H3,(H2,5,8).
What are the key properties of 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide?
5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide has a molecular weight of 207.24 g/mol, XLogP of -0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfonyl-1,3,4-thiadiazole-2-carboxamide is sourced from PubChem (CID 21163834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).