C19H34N2O3S2 — CID 21163972
1,3-bis(2,4,4-trimethylpentan-2-ylsulfanyl)imidazolidine-2,4,5-trione (PubChem CID 21163972) has the molecular formula C19H34N2O3S2 and a molecular weight of 402.63 g/mol. Its IUPAC name is 1,3-bis(2,4,4-trimethylpentan-2-ylsulfanyl)imidazolidine-2,4,5-trione.
| Compound Name | 1,3-bis(2,4,4-trimethylpentan-2-ylsulfanyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 21163972 |
| Molecular Formula | C19H34N2O3S2 |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 1,3-bis(2,4,4-trimethylpentan-2-ylsulfanyl)imidazolidine-2,4,5-trione |
| SMILES | CC(C)(C)CC(C)(C)SN1C(=O)C(=O)N(SC(C)(C)CC(C)(C)C)C1=O |
| InChI | InChI=1S/C19H34N2O3S2/c1-16(2,3)11-18(7,8)25-20-13(22)14(23)21(15(20)24)26-19(9,10)12-17(4,5)6/h11-12H2,1-10H3 |
| InChIKey | JJCJHWIZOQZTHR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|