C20H24N6O2S2 — CID 21166144
2-[[5-[(3,5-dimethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 21166144) has the molecular formula C20H24N6O2S2 and a molecular weight of 444.59 g/mol. Its IUPAC name is 2-[[5-[(3,5-dimethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[[5-[(3,5-dimethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 21166144 |
| Molecular Formula | C20H24N6O2S2 |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-[[5-[(3,5-dimethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | C=CCn1c(COc2cc(C)cc(C)c2)nnc1SCC(=O)Nc1nnc(CC)s1 |
| InChI | InChI=1S/C20H24N6O2S2/c1-5-7-26-16(11-28-15-9-13(3)8-14(4)10-15)22-25-20(26)29-12-17(27)21-19-24-23-18(6-2)30-19/h5,8-10H,1,6-7,11-12H2,2-4H3,(H,21,24,27) |
| InChIKey | KUKASJKXDMVBQR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|