C21H24N6O3S — CID 2116771
2-[[4-amino-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 2116771) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is 2-[[4-amino-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2116771 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[[4-amino-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1ccc(-c2nnc(SCC(=O)Nc3ccc(N4CCOCC4)cc3)n2N)cc1 |
| InChI | InChI=1S/C21H24N6O3S/c1-29-18-8-2-15(3-9-18)20-24-25-21(27(20)22)31-14-19(28)23-16-4-6-17(7-5-16)26-10-12-30-13-11-26/h2-9H,10-14,22H2,1H3,(H,23,28) |
| InChIKey | NVCQVIMFMQOCAS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|