C30H26N2O5S — CID 21167980
methyl 2-[[2-[4-[(3-methoxybenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate (PubChem CID 21167980) has the molecular formula C30H26N2O5S and a molecular weight of 526.61 g/mol. Its IUPAC name is methyl 2-[[2-[4-[(3-methoxybenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[4-[(3-methoxybenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 21167980 |
| Molecular Formula | C30H26N2O5S |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | methyl 2-[[2-[4-[(3-methoxybenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(Sc1ccc(NC(=O)c2cccc(OC)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H26N2O5S/c1-36-23-12-8-11-21(19-23)28(33)31-22-15-17-24(18-16-22)38-27(20-9-4-3-5-10-20)29(34)32-26-14-7-6-13-25(26)30(35)37-2/h3-19,27H,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | KHKVFXNRNGCESX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |