C32H27ClN2O3S — CID 21169835
(5E)-3-benzyl-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 21169835) has the molecular formula C32H27ClN2O3S and a molecular weight of 555.10 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 21169835 |
| Molecular Formula | C32H27ClN2O3S |
| Molecular Weight | 555.10 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | (5E)-3-benzyl-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccccc3)N(Cc3ccccc3)C2=O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H27ClN2O3S/c1-2-37-29-19-25(15-18-28(29)38-22-24-13-16-26(33)17-14-24)20-30-31(36)35(21-23-9-5-3-6-10-23)32(39-30)34-27-11-7-4-8-12-27/h3-20H,2,21-22H2,1H3/b30-20+,34-32- |
| InChIKey | POAOMGCJLCFMHA-HDSDKQTKSA-N |
| XLogP | 8.12 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.10 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|