C11H15NO — CID 21170
N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 21170) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 21170 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C11H15NO/c1-7-5-8(2)11(9(3)6-7)12-10(4)13/h5-6H,1-4H3,(H,12,13) |
| InChIKey | LQWWZVZGPVVZOB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |