C33H29Cl2N3O5S — CID 21172484
[2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-[(6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21172484) has the molecular formula C33H29Cl2N3O5S and a molecular weight of 650.58 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-[(6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-[(6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21172484 |
| Molecular Formula | C33H29Cl2N3O5S |
| Molecular Weight | 650.58 g/mol |
| Exact Mass | 649.12 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-[(6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CC(C)(C)C1CCc2nc(SC3CC(=O)N(c4ccc(C(=O)OCC(=O)c5ccc(Cl)c(Cl)c5)cc4)C3=O)c(C#N)cc2C1 |
| InChI | InChI=1S/C33H29Cl2N3O5S/c1-33(2,3)22-7-11-26-20(13-22)12-21(16-36)30(37-26)44-28-15-29(40)38(31(28)41)23-8-4-18(5-9-23)32(42)43-17-27(39)19-6-10-24(34)25(35)14-19/h4-6,8-10,12,14,22,28H,7,11,13,15,17H2,1-3H3 |
| InChIKey | ZTBSPBTYJWLPSH-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 117.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.58 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|